C19H29N3O2S — CID 111254155
methyl 1-[N-ethyl-N'-[2-(4-methylphenyl)sulfanylethyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111254155) has the molecular formula C19H29N3O2S and a molecular weight of 363.53 g/mol. Its IUPAC name is methyl 1-[N-ethyl-N'-[2-(4-methylphenyl)sulfanylethyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N-ethyl-N'-[2-(4-methylphenyl)sulfanylethyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111254155 |
| Molecular Formula | C19H29N3O2S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | methyl 1-[N-ethyl-N'-[2-(4-methylphenyl)sulfanylethyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCN/C(=N\CCSc1ccc(C)cc1)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C19H29N3O2S/c1-4-20-19(22-12-9-16(10-13-22)18(23)24-3)21-11-14-25-17-7-5-15(2)6-8-17/h5-8,16H,4,9-14H2,1-3H3,(H,20,21) |
| InChIKey | OPTXQDOGXGVFGP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|