C12H14ClF2N — CID 117007699
1-(5-chloro-2-methylphenyl)-3,3-difluoropiperidine (PubChem CID 117007699) has the molecular formula C12H14ClF2N and a molecular weight of 245.70 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-3,3-difluoropiperidine.
| Compound Name | 1-(5-chloro-2-methylphenyl)-3,3-difluoropiperidine |
|---|---|
| PubChem CID | 117007699 |
| Molecular Formula | C12H14ClF2N |
| Molecular Weight | 245.70 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-3,3-difluoropiperidine |
| SMILES | Cc1ccc(Cl)cc1N1CCCC(F)(F)C1 |
| InChI | InChI=1S/C12H14ClF2N/c1-9-3-4-10(13)7-11(9)16-6-2-5-12(14,15)8-16/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | IHPVJNYUTRNDGS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.70 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |