C14H19F2N — CID 117007689
3,3-difluoro-1-(2,4,6-trimethylphenyl)piperidine (PubChem CID 117007689) has the molecular formula C14H19F2N and a molecular weight of 239.31 g/mol. Its IUPAC name is 3,3-difluoro-1-(2,4,6-trimethylphenyl)piperidine.
| Compound Name | 3,3-difluoro-1-(2,4,6-trimethylphenyl)piperidine |
|---|---|
| PubChem CID | 117007689 |
| Molecular Formula | C14H19F2N |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 3,3-difluoro-1-(2,4,6-trimethylphenyl)piperidine |
| SMILES | Cc1cc(C)c(N2CCCC(F)(F)C2)c(C)c1 |
| InChI | InChI=1S/C14H19F2N/c1-10-7-11(2)13(12(3)8-10)17-6-4-5-14(15,16)9-17/h7-8H,4-6,9H2,1-3H3 |
| InChIKey | BMQNAUJYEWCYRW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |