C13H15F2NO2 — CID 117007729
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,3-difluoropiperidine (PubChem CID 117007729) has the molecular formula C13H15F2NO2 and a molecular weight of 255.26 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,3-difluoropiperidine.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,3-difluoropiperidine |
|---|---|
| PubChem CID | 117007729 |
| Molecular Formula | C13H15F2NO2 |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,3-difluoropiperidine |
| SMILES | FC1(F)CCCN(c2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C13H15F2NO2/c14-13(15)4-1-5-16(9-13)10-2-3-11-12(8-10)18-7-6-17-11/h2-3,8H,1,4-7,9H2 |
| InChIKey | AIMOHDSRTFPZAI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|