C15H20F2N2O — CID 167388987
N-[3-(3,3-difluoropiperidin-1-yl)-2,6-dimethylphenyl]acetamide (PubChem CID 167388987) has the molecular formula C15H20F2N2O and a molecular weight of 282.33 g/mol. Its IUPAC name is N-[3-(3,3-difluoropiperidin-1-yl)-2,6-dimethylphenyl]acetamide.
| Compound Name | N-[3-(3,3-difluoropiperidin-1-yl)-2,6-dimethylphenyl]acetamide |
|---|---|
| PubChem CID | 167388987 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-[3-(3,3-difluoropiperidin-1-yl)-2,6-dimethylphenyl]acetamide |
| SMILES | CC(=O)Nc1c(C)ccc(N2CCCC(F)(F)C2)c1C |
| InChI | InChI=1S/C15H20F2N2O/c1-10-5-6-13(11(2)14(10)18-12(3)20)19-8-4-7-15(16,17)9-19/h5-6H,4,7-9H2,1-3H3,(H,18,20) |
| InChIKey | DTOOVTYHVCBLLE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |