C21H31F2N3O2 — CID 169488619
tert-butyl 4-[3-amino-4-(3,3-difluoropiperidin-1-yl)phenyl]piperidine-1-carboxylate (PubChem CID 169488619) has the molecular formula C21H31F2N3O2 and a molecular weight of 395.49 g/mol. Its IUPAC name is tert-butyl 4-[3-amino-4-(3,3-difluoropiperidin-1-yl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-amino-4-(3,3-difluoropiperidin-1-yl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169488619 |
| Molecular Formula | C21H31F2N3O2 |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | tert-butyl 4-[3-amino-4-(3,3-difluoropiperidin-1-yl)phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(N3CCCC(F)(F)C3)c(N)c2)CC1 |
| InChI | InChI=1S/C21H31F2N3O2/c1-20(2,3)28-19(27)25-11-7-15(8-12-25)16-5-6-18(17(24)13-16)26-10-4-9-21(22,23)14-26/h5-6,13,15H,4,7-12,14,24H2,1-3H3 |
| InChIKey | OSKYPUDLFXRPHN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|