C22H35N3O2 — CID 169488617
tert-butyl 4-[3-amino-4-(3-methylpiperidin-1-yl)phenyl]piperidine-1-carboxylate (PubChem CID 169488617) has the molecular formula C22H35N3O2 and a molecular weight of 373.54 g/mol. Its IUPAC name is tert-butyl 4-[3-amino-4-(3-methylpiperidin-1-yl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-amino-4-(3-methylpiperidin-1-yl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169488617 |
| Molecular Formula | C22H35N3O2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | tert-butyl 4-[3-amino-4-(3-methylpiperidin-1-yl)phenyl]piperidine-1-carboxylate |
| SMILES | CC1CCCN(c2ccc(C3CCN(C(=O)OC(C)(C)C)CC3)cc2N)C1 |
| InChI | InChI=1S/C22H35N3O2/c1-16-6-5-11-25(15-16)20-8-7-18(14-19(20)23)17-9-12-24(13-10-17)21(26)27-22(2,3)4/h7-8,14,16-17H,5-6,9-13,15,23H2,1-4H3 |
| InChIKey | VHNASWRVIRFHDM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|