C10H12INO — CID 4608715
N-(3-iodo-2,6-dimethylphenyl)acetamide (PubChem CID 4608715) has the molecular formula C10H12INO and a molecular weight of 289.12 g/mol. Its IUPAC name is N-(3-iodo-2,6-dimethylphenyl)acetamide.
| Compound Name | N-(3-iodo-2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 4608715 |
| Molecular Formula | C10H12INO |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | N-(3-iodo-2,6-dimethylphenyl)acetamide |
| SMILES | CC(=O)Nc1c(C)ccc(I)c1C |
| InChI | InChI=1S/C10H12INO/c1-6-4-5-9(11)7(2)10(6)12-8(3)13/h4-5H,1-3H3,(H,12,13) |
| InChIKey | KFEJFGWXSVLCQA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|