About (3-acetamido-6-iodo-2,4-dimethylphenyl)methyl acetate
(3-acetamido-6-iodo-2,4-dimethylphenyl)methyl acetate (PubChem CID 59731922) has the molecular formula C13H16INO3
and a molecular weight of 361.18 g/mol. Its IUPAC name is (3-acetamido-6-iodo-2,4-dimethylphenyl)methyl acetate.
Molecular Properties
| Compound Name | (3-acetamido-6-iodo-2,4-dimethylphenyl)methyl acetate |
| PubChem CID | 59731922 |
| Molecular Formula | C13H16INO3 |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | (3-acetamido-6-iodo-2,4-dimethylphenyl)methyl acetate |
| SMILES | CC(=O)Nc1c(C)cc(I)c(COC(C)=O)c1C |
| InChI | InChI=1S/C13H16INO3/c1-7-5-12(14)11(6-18-10(4)17)8(2)13(7)15-9(3)16/h5H,6H2,1-4H3,(H,15,16) |
| InChIKey | SJSJKHNBAZEEDK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3-acetamido-6-iodo-2,4-dimethylphenyl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetamido-6-iodo-2,4-dimethylphenyl)methyl acetate?
The IUPAC name of (3-acetamido-6-iodo-2,4-dimethylphenyl)methyl acetate (CID 59731922) is (3-acetamido-6-iodo-2,4-dimethylphenyl)methyl acetate.
What is the SMILES notation for (3-acetamido-6-iodo-2,4-dimethylphenyl)methyl acetate?
The canonical SMILES for (3-acetamido-6-iodo-2,4-dimethylphenyl)methyl acetate is CC(=O)Nc1c(C)cc(I)c(COC(C)=O)c1C.
What is the InChIKey of (3-acetamido-6-iodo-2,4-dimethylphenyl)methyl acetate?
The InChIKey is SJSJKHNBAZEEDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16INO3/c1-7-5-12(14)11(6-18-10(4)17)8(2)13(7)15-9(3)16/h5H,6H2,1-4H3,(H,15,16).
What are the key properties of (3-acetamido-6-iodo-2,4-dimethylphenyl)methyl acetate?
(3-acetamido-6-iodo-2,4-dimethylphenyl)methyl acetate has a molecular weight of 361.18 g/mol, XLogP of 2.93, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetamido-6-iodo-2,4-dimethylphenyl)methyl acetate is sourced from PubChem (CID 59731922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).