C13H15ClF3NO2 — CID 155581589
2-chloro-N-[2,3-dimethyl-6-(2,2,2-trifluoroethoxymethyl)phenyl]acetamide (PubChem CID 155581589) has the molecular formula C13H15ClF3NO2 and a molecular weight of 309.72 g/mol. Its IUPAC name is 2-chloro-N-[2,3-dimethyl-6-(2,2,2-trifluoroethoxymethyl)phenyl]acetamide.
| Compound Name | 2-chloro-N-[2,3-dimethyl-6-(2,2,2-trifluoroethoxymethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 155581589 |
| Molecular Formula | C13H15ClF3NO2 |
| Molecular Weight | 309.72 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-chloro-N-[2,3-dimethyl-6-(2,2,2-trifluoroethoxymethyl)phenyl]acetamide |
| SMILES | Cc1ccc(COCC(F)(F)F)c(NC(=O)CCl)c1C |
| InChI | InChI=1S/C13H15ClF3NO2/c1-8-3-4-10(6-20-7-13(15,16)17)12(9(8)2)18-11(19)5-14/h3-4H,5-7H2,1-2H3,(H,18,19) |
| InChIKey | OGEHPIGKQYGFCD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.72 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|