C13H16ClF3N2O2 — CID 63829118
N-(5-chloro-2-methylphenyl)-2-[2-(2,2,2-trifluoroethoxy)ethylamino]acetamide (PubChem CID 63829118) has the molecular formula C13H16ClF3N2O2 and a molecular weight of 324.73 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2-[2-(2,2,2-trifluoroethoxy)ethylamino]acetamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2-[2-(2,2,2-trifluoroethoxy)ethylamino]acetamide |
|---|---|
| PubChem CID | 63829118 |
| Molecular Formula | C13H16ClF3N2O2 |
| Molecular Weight | 324.73 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2-[2-(2,2,2-trifluoroethoxy)ethylamino]acetamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)CNCCOCC(F)(F)F |
| InChI | InChI=1S/C13H16ClF3N2O2/c1-9-2-3-10(14)6-11(9)19-12(20)7-18-4-5-21-8-13(15,16)17/h2-3,6,18H,4-5,7-8H2,1H3,(H,19,20) |
| InChIKey | IHFPFOBIUOIOGD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.73 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|