C13H16ClF3N2O3 — CID 119785490
N-[4-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-2-(2-methoxyethylamino)acetamide (PubChem CID 119785490) has the molecular formula C13H16ClF3N2O3 and a molecular weight of 340.73 g/mol. Its IUPAC name is N-[4-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-2-(2-methoxyethylamino)acetamide.
| Compound Name | N-[4-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-2-(2-methoxyethylamino)acetamide |
|---|---|
| PubChem CID | 119785490 |
| Molecular Formula | C13H16ClF3N2O3 |
| Molecular Weight | 340.73 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | N-[4-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-2-(2-methoxyethylamino)acetamide |
| SMILES | COCCNCC(=O)Nc1ccc(Cl)cc1OCC(F)(F)F |
| InChI | InChI=1S/C13H16ClF3N2O3/c1-21-5-4-18-7-12(20)19-10-3-2-9(14)6-11(10)22-8-13(15,16)17/h2-3,6,18H,4-5,7-8H2,1H3,(H,19,20) |
| InChIKey | IEHOMDYTVABQCZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.73 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|