C8H11NOS — CID 71412387
N-(2,4-dimethylthiophen-3-yl)acetamide (PubChem CID 71412387) has the molecular formula C8H11NOS and a molecular weight of 169.25 g/mol. Its IUPAC name is N-(2,4-dimethylthiophen-3-yl)acetamide.
| Compound Name | N-(2,4-dimethylthiophen-3-yl)acetamide |
|---|---|
| PubChem CID | 71412387 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | N-(2,4-dimethylthiophen-3-yl)acetamide |
| SMILES | CC(=O)Nc1c(C)csc1C |
| InChI | InChI=1S/C8H11NOS/c1-5-4-11-6(2)8(5)9-7(3)10/h4H,1-3H3,(H,9,10) |
| InChIKey | JOCWOUBHQIYPGP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |