C13H23NO2S — CID 155737680
tert-butyl N-(2,4-dimethylthiophen-3-yl)carbamate;ethane (PubChem CID 155737680) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is tert-butyl N-(2,4-dimethylthiophen-3-yl)carbamate;ethane.
| Compound Name | tert-butyl N-(2,4-dimethylthiophen-3-yl)carbamate;ethane |
|---|---|
| PubChem CID | 155737680 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | tert-butyl N-(2,4-dimethylthiophen-3-yl)carbamate;ethane |
| SMILES | CC.Cc1csc(C)c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H17NO2S.C2H6/c1-7-6-15-8(2)9(7)12-10(13)14-11(3,4)5;1-2/h6H,1-5H3,(H,12,13);1-2H3 |
| InChIKey | RQUFPLFXFLUMNZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |