C11H14ClNO4S — CID 162346378
methyl 5-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-3-carboxylate (PubChem CID 162346378) has the molecular formula C11H14ClNO4S and a molecular weight of 291.76 g/mol. Its IUPAC name is methyl 5-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-3-carboxylate.
| Compound Name | methyl 5-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 162346378 |
| Molecular Formula | C11H14ClNO4S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | methyl 5-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1csc(Cl)c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H14ClNO4S/c1-11(2,3)17-10(15)13-7-6(9(14)16-4)5-18-8(7)12/h5H,1-4H3,(H,13,15) |
| InChIKey | XIGHVFBMZPHZQR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |