C17H18ClNO5 — CID 168911909
methyl 5-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]furan-3-carboxylate (PubChem CID 168911909) has the molecular formula C17H18ClNO5 and a molecular weight of 351.79 g/mol. Its IUPAC name is methyl 5-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]furan-3-carboxylate.
| Compound Name | methyl 5-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]furan-3-carboxylate |
|---|---|
| PubChem CID | 168911909 |
| Molecular Formula | C17H18ClNO5 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | methyl 5-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]furan-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccc(Cl)cc2)oc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H18ClNO5/c1-17(2,3)24-16(21)19-14-12(15(20)22-4)9-13(23-14)10-5-7-11(18)8-6-10/h5-9H,1-4H3,(H,19,21) |
| InChIKey | IVABJUZZYGJGMC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |