C16H24N2OS — CID 174849650
N-(2,4-dimethylthiophen-3-yl)-1-(2-methylprop-2-enyl)piperidine-2-carboxamide (PubChem CID 174849650) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is N-(2,4-dimethylthiophen-3-yl)-1-(2-methylprop-2-enyl)piperidine-2-carboxamide.
| Compound Name | N-(2,4-dimethylthiophen-3-yl)-1-(2-methylprop-2-enyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 174849650 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-(2,4-dimethylthiophen-3-yl)-1-(2-methylprop-2-enyl)piperidine-2-carboxamide |
| SMILES | C=C(C)CN1CCCCC1C(=O)Nc1c(C)csc1C |
| InChI | InChI=1S/C16H24N2OS/c1-11(2)9-18-8-6-5-7-14(18)16(19)17-15-12(3)10-20-13(15)4/h10,14H,1,5-9H2,2-4H3,(H,17,19) |
| InChIKey | ZUSSNNGCKNASBZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|