C16H22N2OS — CID 141479959
(2S)-N-(2-ethynyl-4-methylthiophen-3-yl)-1-propylpiperidine-2-carboxamide (PubChem CID 141479959) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is (2S)-N-(2-ethynyl-4-methylthiophen-3-yl)-1-propylpiperidine-2-carboxamide.
| Compound Name | (2S)-N-(2-ethynyl-4-methylthiophen-3-yl)-1-propylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 141479959 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (2S)-N-(2-ethynyl-4-methylthiophen-3-yl)-1-propylpiperidine-2-carboxamide |
| SMILES | C#Cc1scc(C)c1NC(=O)[C@@H]1CCCCN1CCC |
| InChI | InChI=1S/C16H22N2OS/c1-4-9-18-10-7-6-8-13(18)16(19)17-15-12(3)11-20-14(15)5-2/h2,11,13H,4,6-10H2,1,3H3,(H,17,19)/t13-/m0/s1 |
| InChIKey | HCPOPLJHCOGTSQ-ZDUSSCGKSA-N |
| XLogP | 3.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|