C11H12N2O2 — CID 169353390
N-(3-isocyanato-2,6-dimethylphenyl)acetamide (PubChem CID 169353390) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is N-(3-isocyanato-2,6-dimethylphenyl)acetamide.
| Compound Name | N-(3-isocyanato-2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 169353390 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | N-(3-isocyanato-2,6-dimethylphenyl)acetamide |
| SMILES | CC(=O)Nc1c(C)ccc(N=C=O)c1C |
| InChI | InChI=1S/C11H12N2O2/c1-7-4-5-10(12-6-14)8(2)11(7)13-9(3)15/h4-5H,1-3H3,(H,13,15) |
| InChIKey | YQTLSFLKYBNEFN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|