C9H6N2O3 — CID 23295090
3,4-diisocyanato-2-methylphenol (PubChem CID 23295090) has the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. Its IUPAC name is 3,4-diisocyanato-2-methylphenol.
| Compound Name | 3,4-diisocyanato-2-methylphenol |
|---|---|
| PubChem CID | 23295090 |
| Molecular Formula | C9H6N2O3 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | 3,4-diisocyanato-2-methylphenol |
| SMILES | Cc1c(O)ccc(N=C=O)c1N=C=O |
| InChI | InChI=1S/C9H6N2O3/c1-6-8(14)3-2-7(10-4-12)9(6)11-5-13/h2-3,14H,1H3 |
| InChIKey | YAPBILDQDDVRGW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|