C12H16F2N2 — CID 115035536
[2-(3,3-difluoropiperidin-1-yl)phenyl]methanamine (PubChem CID 115035536) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is [2-(3,3-difluoropiperidin-1-yl)phenyl]methanamine.
| Compound Name | [2-(3,3-difluoropiperidin-1-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 115035536 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | [2-(3,3-difluoropiperidin-1-yl)phenyl]methanamine |
| SMILES | NCc1ccccc1N1CCCC(F)(F)C1 |
| InChI | InChI=1S/C12H16F2N2/c13-12(14)6-3-7-16(9-12)11-5-2-1-4-10(11)8-15/h1-2,4-5H,3,6-9,15H2 |
| InChIKey | UWAHFBMEZFCRCQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |