About 1-[2-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-4-methylpiperazine
1-[2-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-4-methylpiperazine (PubChem CID 166093263) has the molecular formula C16H23F2N3
and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-[2-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-4-methylpiperazine.
Molecular Properties
| Compound Name | 1-[2-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-4-methylpiperazine |
| PubChem CID | 166093263 |
| Molecular Formula | C16H23F2N3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 1-[2-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-4-methylpiperazine |
| SMILES | CN1CCN(c2ccccc2CN2CCC(F)(F)C2)CC1 |
| InChI | InChI=1S/C16H23F2N3/c1-19-8-10-21(11-9-19)15-5-3-2-4-14(15)12-20-7-6-16(17,18)13-20/h2-5H,6-13H2,1H3 |
| InChIKey | SQUIXLLSIJQCOO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-4-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-4-methylpiperazine?
The IUPAC name of 1-[2-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-4-methylpiperazine (CID 166093263) is 1-[2-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-4-methylpiperazine.
What is the SMILES notation for 1-[2-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-4-methylpiperazine?
The canonical SMILES for 1-[2-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-4-methylpiperazine is CN1CCN(c2ccccc2CN2CCC(F)(F)C2)CC1.
What is the InChIKey of 1-[2-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-4-methylpiperazine?
The InChIKey is SQUIXLLSIJQCOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23F2N3/c1-19-8-10-21(11-9-19)15-5-3-2-4-14(15)12-20-7-6-16(17,18)13-20/h2-5H,6-13H2,1H3.
What are the key properties of 1-[2-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-4-methylpiperazine?
1-[2-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-4-methylpiperazine has a molecular weight of 295.38 g/mol, XLogP of 2.28, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-4-methylpiperazine is sourced from PubChem (CID 166093263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).