C13H14ClNO2 — CID 106315203
2-chloro-4-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid (PubChem CID 106315203) has the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. Its IUPAC name is 2-chloro-4-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid.
| Compound Name | 2-chloro-4-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 106315203 |
| Molecular Formula | C13H14ClNO2 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-chloro-4-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid |
| SMILES | CC1=CCCN(c2ccc(C(=O)O)c(Cl)c2)C1 |
| InChI | InChI=1S/C13H14ClNO2/c1-9-3-2-6-15(8-9)10-4-5-11(13(16)17)12(14)7-10/h3-5,7H,2,6,8H2,1H3,(H,16,17) |
| InChIKey | TZLVXXYPLOLPKI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|