C12H16N2 — CID 130865447
3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)aniline (PubChem CID 130865447) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)aniline.
| Compound Name | 3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)aniline |
|---|---|
| PubChem CID | 130865447 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 3-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)aniline |
| SMILES | CC1=CCCN(c2cccc(N)c2)C1 |
| InChI | InChI=1S/C12H16N2/c1-10-4-3-7-14(9-10)12-6-2-5-11(13)8-12/h2,4-6,8H,3,7,9,13H2,1H3 |
| InChIKey | SMSXBRUIGNMEPS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|