C11H14N2 — CID 130964450
3-(3,6-dihydro-2H-pyridin-1-yl)aniline (PubChem CID 130964450) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 3-(3,6-dihydro-2H-pyridin-1-yl)aniline.
| Compound Name | 3-(3,6-dihydro-2H-pyridin-1-yl)aniline |
|---|---|
| PubChem CID | 130964450 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 3-(3,6-dihydro-2H-pyridin-1-yl)aniline |
| SMILES | Nc1cccc(N2CC=CCC2)c1 |
| InChI | InChI=1S/C11H14N2/c12-10-5-4-6-11(9-10)13-7-2-1-3-8-13/h1-2,4-6,9H,3,7-8,12H2 |
| InChIKey | QKDAZSCBHDJONU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|