C19H21N — CID 131997914
1-[3-(3,4,5-trimethylcyclopenta-1,2,4-trien-1-yl)phenyl]-3,6-dihydro-2H-pyridine (PubChem CID 131997914) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is 1-[3-(3,4,5-trimethylcyclopenta-1,2,4-trien-1-yl)phenyl]-3,6-dihydro-2H-pyridine.
| Compound Name | 1-[3-(3,4,5-trimethylcyclopenta-1,2,4-trien-1-yl)phenyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 131997914 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 1-[3-(3,4,5-trimethylcyclopenta-1,2,4-trien-1-yl)phenyl]-3,6-dihydro-2H-pyridine |
| SMILES | CC1=C=C(c2cccc(N3CC=CCC3)c2)C(C)=C1C |
| InChI | InChI=1S/C19H21N/c1-14-12-19(16(3)15(14)2)17-8-7-9-18(13-17)20-10-5-4-6-11-20/h4-5,7-9,13H,6,10-11H2,1-3H3 |
| InChIKey | WNSYGHJUKYUBGN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|