2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid

C13H15NO2 — CID 106314434

IUPAC2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid
SMILESCC1=CCCN(c2ccccc2C(=O)O)C1
InChIInChI=1S/C13H15NO2/c1-10-5-4-8-14(9-10)12-7-3-2-6-11(12)13(15)16/h2-3,5-7H,4,8-9H2,1H3,(H,15,16)
InChIKeyVWGALNVPCRPIIO-UHFFFAOYSA-N
MW217.27 g/mol
LogP2.54
Rot. Bonds2

About 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid

2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid (PubChem CID 106314434) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid.

Molecular Properties

Compound Name2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid
PubChem CID106314434
Molecular FormulaC13H15NO2
Molecular Weight217.27 g/mol
Exact Mass217.11
IUPAC Name2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid
SMILESCC1=CCCN(c2ccccc2C(=O)O)C1
InChIInChI=1S/C13H15NO2/c1-10-5-4-8-14(9-10)12-7-3-2-6-11(12)13(15)16/h2-3,5-7H,4,8-9H2,1H3,(H,15,16)
InChIKeyVWGALNVPCRPIIO-UHFFFAOYSA-N
XLogP2.54
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.27
LogP ≤ 52.54
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid?
The IUPAC name of 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid (CID 106314434) is 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid.
What is the SMILES notation for 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid?
The canonical SMILES for 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid is CC1=CCCN(c2ccccc2C(=O)O)C1.
What is the InChIKey of 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid?
The InChIKey is VWGALNVPCRPIIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c1-10-5-4-8-14(9-10)12-7-3-2-6-11(12)13(15)16/h2-3,5-7H,4,8-9H2,1H3,(H,15,16).
What are the key properties of 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid?
2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid has a molecular weight of 217.27 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid is sourced from PubChem (CID 106314434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).