About phthalic acid;toluene
phthalic acid;toluene (PubChem CID 174855044) has the molecular formula C22H22O4
and a molecular weight of 350.41 g/mol. Its IUPAC name is phthalic acid;toluene.
Molecular Properties
| Compound Name | phthalic acid;toluene |
| PubChem CID | 174855044 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | phthalic acid;toluene |
| SMILES | Cc1ccccc1.Cc1ccccc1.O=C(O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C8H6O4.2C7H8/c9-7(10)5-3-1-2-4-6(5)8(11)12;2*1-7-5-3-2-4-6-7/h1-4H,(H,9,10)(H,11,12);2*2-6H,1H3 |
| InChIKey | MNBHHXKRFOKHNI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phthalic acid;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phthalic acid;toluene?
The IUPAC name of phthalic acid;toluene (CID 174855044) is phthalic acid;toluene.
What is the SMILES notation for phthalic acid;toluene?
The canonical SMILES for phthalic acid;toluene is Cc1ccccc1.Cc1ccccc1.O=C(O)c1ccccc1C(=O)O.
What is the InChIKey of phthalic acid;toluene?
The InChIKey is MNBHHXKRFOKHNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.2C7H8/c9-7(10)5-3-1-2-4-6(5)8(11)12;2*1-7-5-3-2-4-6-7/h1-4H,(H,9,10)(H,11,12);2*2-6H,1H3.
What are the key properties of phthalic acid;toluene?
phthalic acid;toluene has a molecular weight of 350.41 g/mol, XLogP of 5.07, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phthalic acid;toluene is sourced from PubChem (CID 174855044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).