C12H13BClF5N2O2 — CID 169248995
[5-chloro-2-(4,4-difluoroazepan-1-yl)-6-(trifluoromethyl)-3-pyridinyl]boronic acid (PubChem CID 169248995) has the molecular formula C12H13BClF5N2O2 and a molecular weight of 358.50 g/mol. Its IUPAC name is [5-chloro-2-(4,4-difluoroazepan-1-yl)-6-(trifluoromethyl)-3-pyridinyl]boronic acid.
| Compound Name | [5-chloro-2-(4,4-difluoroazepan-1-yl)-6-(trifluoromethyl)-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 169248995 |
| Molecular Formula | C12H13BClF5N2O2 |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | [5-chloro-2-(4,4-difluoroazepan-1-yl)-6-(trifluoromethyl)-3-pyridinyl]boronic acid |
| SMILES | OB(O)c1cc(Cl)c(C(F)(F)F)nc1N1CCCC(F)(F)CC1 |
| InChI | InChI=1S/C12H13BClF5N2O2/c14-8-6-7(13(22)23)10(20-9(8)12(17,18)19)21-4-1-2-11(15,16)3-5-21/h6,22-23H,1-5H2 |
| InChIKey | SBYRNEHDSOMUDW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|