C15H22ClF2N3 — CID 169249091
6-tert-butyl-5-chloro-2-(4,4-difluoroazepan-1-yl)pyridin-3-amine (PubChem CID 169249091) has the molecular formula C15H22ClF2N3 and a molecular weight of 317.81 g/mol. Its IUPAC name is 6-tert-butyl-5-chloro-2-(4,4-difluoroazepan-1-yl)pyridin-3-amine.
| Compound Name | 6-tert-butyl-5-chloro-2-(4,4-difluoroazepan-1-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 169249091 |
| Molecular Formula | C15H22ClF2N3 |
| Molecular Weight | 317.81 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 6-tert-butyl-5-chloro-2-(4,4-difluoroazepan-1-yl)pyridin-3-amine |
| SMILES | CC(C)(C)c1nc(N2CCCC(F)(F)CC2)c(N)cc1Cl |
| InChI | InChI=1S/C15H22ClF2N3/c1-14(2,3)12-10(16)9-11(19)13(20-12)21-7-4-5-15(17,18)6-8-21/h9H,4-8,19H2,1-3H3 |
| InChIKey | FFHHUCCLUDCKEO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.81 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |