C22H21F5N4OSr — CID 169123983
strontium;carbanide;5-cyano-2-(4,4-difluoroazepan-1-yl)-4-methyl-N-phenyl-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 169123983) has the molecular formula C22H21F5N4OSr and a molecular weight of 540.05 g/mol. Its IUPAC name is strontium;carbanide;5-cyano-2-(4,4-difluoroazepan-1-yl)-4-methyl-N-phenyl-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | strontium;carbanide;5-cyano-2-(4,4-difluoroazepan-1-yl)-4-methyl-N-phenyl-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 169123983 |
| Molecular Formula | C22H21F5N4OSr |
| Molecular Weight | 540.05 g/mol |
| Exact Mass | 540.07 |
| IUPAC Name | strontium;carbanide;5-cyano-2-(4,4-difluoroazepan-1-yl)-4-methyl-N-phenyl-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | Cc1c(C#N)c(C(F)(F)F)nc(N2CCCC(F)(F)CC2)c1C(=O)Nc1c[c-]ccc1.[CH3-].[Sr+2] |
| InChI | InChI=1S/C21H18F5N4O.CH3.Sr/c1-13-15(12-27)17(21(24,25)26)29-18(30-10-5-8-20(22,23)9-11-30)16(13)19(31)28-14-6-3-2-4-7-14;;/h2-3,6-7H,5,8-11H2,1H3,(H,28,31);1H3;/q2*-1;+2 |
| InChIKey | MNERUQOUUKJPBJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.05 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|