C22H22ClN3O2 — CID 170188116
[(1R)-1-(7-chloro-1-piperidin-1-yl-2,6-naphthyridin-3-yl)ethyl] benzoate (PubChem CID 170188116) has the molecular formula C22H22ClN3O2 and a molecular weight of 395.89 g/mol. Its IUPAC name is [(1R)-1-(7-chloro-1-piperidin-1-yl-2,6-naphthyridin-3-yl)ethyl] benzoate.
| Compound Name | [(1R)-1-(7-chloro-1-piperidin-1-yl-2,6-naphthyridin-3-yl)ethyl] benzoate |
|---|---|
| PubChem CID | 170188116 |
| Molecular Formula | C22H22ClN3O2 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | [(1R)-1-(7-chloro-1-piperidin-1-yl-2,6-naphthyridin-3-yl)ethyl] benzoate |
| SMILES | C[C@@H](OC(=O)c1ccccc1)c1cc2cnc(Cl)cc2c(N2CCCCC2)n1 |
| InChI | InChI=1S/C22H22ClN3O2/c1-15(28-22(27)16-8-4-2-5-9-16)19-12-17-14-24-20(23)13-18(17)21(25-19)26-10-6-3-7-11-26/h2,4-5,8-9,12-15H,3,6-7,10-11H2,1H3/t15-/m1/s1 |
| InChIKey | IIJUVDDYJUNZRS-OAHLLOKOSA-N |
| XLogP | 5.19 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|