C21H21Cl3N4O3 — CID 135181401
1-[6-chloro-2-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-4-yl]-4-methylpiperidin-4-ol (PubChem CID 135181401) has the molecular formula C21H21Cl3N4O3 and a molecular weight of 483.78 g/mol. Its IUPAC name is 1-[6-chloro-2-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-4-yl]-4-methylpiperidin-4-ol.
| Compound Name | 1-[6-chloro-2-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-4-yl]-4-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 135181401 |
| Molecular Formula | C21H21Cl3N4O3 |
| Molecular Weight | 483.78 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | 1-[6-chloro-2-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-4-yl]-4-methylpiperidin-4-ol |
| SMILES | COc1cc(OC)c(Cl)c(-c2nc(N3CCC(C)(O)CC3)c3cc(Cl)ncc3n2)c1Cl |
| InChI | InChI=1S/C21H21Cl3N4O3/c1-21(29)4-6-28(7-5-21)20-11-8-15(22)25-10-12(11)26-19(27-20)16-17(23)13(30-2)9-14(31-3)18(16)24/h8-10,29H,4-7H2,1-3H3 |
| InChIKey | KOUUNFMOONTSIM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 80.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.78 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|