C20H18Cl2F2N4O2 — CID 142381002
6-chloro-2-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-4-(3,3-difluoroazetidin-1-yl)pyrido[3,4-d]pyrimidine (PubChem CID 142381002) has the molecular formula C20H18Cl2F2N4O2 and a molecular weight of 455.29 g/mol. Its IUPAC name is 6-chloro-2-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-4-(3,3-difluoroazetidin-1-yl)pyrido[3,4-d]pyrimidine.
| Compound Name | 6-chloro-2-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-4-(3,3-difluoroazetidin-1-yl)pyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 142381002 |
| Molecular Formula | C20H18Cl2F2N4O2 |
| Molecular Weight | 455.29 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 6-chloro-2-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-4-(3,3-difluoroazetidin-1-yl)pyrido[3,4-d]pyrimidine |
| SMILES | CCc1c(OC)cc(OC)c(Cl)c1-c1nc(N2CC(F)(F)C2)c2cc(Cl)ncc2n1 |
| InChI | InChI=1S/C20H18Cl2F2N4O2/c1-4-10-13(29-2)6-14(30-3)17(22)16(10)18-26-12-7-25-15(21)5-11(12)19(27-18)28-8-20(23,24)9-28/h5-7H,4,8-9H2,1-3H3 |
| InChIKey | RJGPQVSUSSFJCI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.29 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|