C22H25ClFN4O3P — CID 142381065
[2-[6-chloro-4-(4-methoxy-4-methylpiperidin-1-yl)pyrido[3,4-d]pyrimidin-2-yl]-3-fluoro-4,6-dimethoxyphenyl]phosphane (PubChem CID 142381065) has the molecular formula C22H25ClFN4O3P and a molecular weight of 478.89 g/mol. Its IUPAC name is [2-[6-chloro-4-(4-methoxy-4-methylpiperidin-1-yl)pyrido[3,4-d]pyrimidin-2-yl]-3-fluoro-4,6-dimethoxyphenyl]phosphane.
| Compound Name | [2-[6-chloro-4-(4-methoxy-4-methylpiperidin-1-yl)pyrido[3,4-d]pyrimidin-2-yl]-3-fluoro-4,6-dimethoxyphenyl]phosphane |
|---|---|
| PubChem CID | 142381065 |
| Molecular Formula | C22H25ClFN4O3P |
| Molecular Weight | 478.89 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | [2-[6-chloro-4-(4-methoxy-4-methylpiperidin-1-yl)pyrido[3,4-d]pyrimidin-2-yl]-3-fluoro-4,6-dimethoxyphenyl]phosphane |
| SMILES | COc1cc(OC)c(P)c(-c2nc(N3CCC(C)(OC)CC3)c3cc(Cl)ncc3n2)c1F |
| InChI | InChI=1S/C22H25ClFN4O3P/c1-22(31-4)5-7-28(8-6-22)21-12-9-16(23)25-11-13(12)26-20(27-21)17-18(24)14(29-2)10-15(30-3)19(17)32/h9-11H,5-8,32H2,1-4H3 |
| InChIKey | MICLERPXNNCTOB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 69.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.89 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|