C16H12ClF2N3O2 — CID 155259775
7-chloro-3-(2,6-difluoro-3,5-dimethoxyphenyl)-1,6-naphthyridin-2-amine (PubChem CID 155259775) has the molecular formula C16H12ClF2N3O2 and a molecular weight of 351.74 g/mol. Its IUPAC name is 7-chloro-3-(2,6-difluoro-3,5-dimethoxyphenyl)-1,6-naphthyridin-2-amine.
| Compound Name | 7-chloro-3-(2,6-difluoro-3,5-dimethoxyphenyl)-1,6-naphthyridin-2-amine |
|---|---|
| PubChem CID | 155259775 |
| Molecular Formula | C16H12ClF2N3O2 |
| Molecular Weight | 351.74 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 7-chloro-3-(2,6-difluoro-3,5-dimethoxyphenyl)-1,6-naphthyridin-2-amine |
| SMILES | COc1cc(OC)c(F)c(-c2cc3cnc(Cl)cc3nc2N)c1F |
| InChI | InChI=1S/C16H12ClF2N3O2/c1-23-10-5-11(24-2)15(19)13(14(10)18)8-3-7-6-21-12(17)4-9(7)22-16(8)20/h3-6H,1-2H3,(H2,20,22) |
| InChIKey | HNNPZNJVTQGDSU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.74 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|