C19H19ClN2O3 — CID 139396179
7-chloro-3-(3,5-dimethoxy-2,6-dimethylphenyl)-1-methyl-1,6-naphthyridin-2-one (PubChem CID 139396179) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is 7-chloro-3-(3,5-dimethoxy-2,6-dimethylphenyl)-1-methyl-1,6-naphthyridin-2-one.
| Compound Name | 7-chloro-3-(3,5-dimethoxy-2,6-dimethylphenyl)-1-methyl-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 139396179 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 7-chloro-3-(3,5-dimethoxy-2,6-dimethylphenyl)-1-methyl-1,6-naphthyridin-2-one |
| SMILES | COc1cc(OC)c(C)c(-c2cc3cnc(Cl)cc3n(C)c2=O)c1C |
| InChI | InChI=1S/C19H19ClN2O3/c1-10-15(24-4)8-16(25-5)11(2)18(10)13-6-12-9-21-17(20)7-14(12)22(3)19(13)23/h6-9H,1-5H3 |
| InChIKey | MKUKCWWITQJPHU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|