C19H17Cl3N2O3 — CID 142381060
7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-propyl-1,6-naphthyridin-2-one (PubChem CID 142381060) has the molecular formula C19H17Cl3N2O3 and a molecular weight of 427.72 g/mol. Its IUPAC name is 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-propyl-1,6-naphthyridin-2-one.
| Compound Name | 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-propyl-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 142381060 |
| Molecular Formula | C19H17Cl3N2O3 |
| Molecular Weight | 427.72 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-propyl-1,6-naphthyridin-2-one |
| SMILES | CCCn1c(=O)c(-c2c(Cl)c(OC)cc(OC)c2Cl)cc2cnc(Cl)cc21 |
| InChI | InChI=1S/C19H17Cl3N2O3/c1-4-5-24-12-7-15(20)23-9-10(12)6-11(19(24)25)16-17(21)13(26-2)8-14(27-3)18(16)22/h6-9H,4-5H2,1-3H3 |
| InChIKey | CMDJFPOVPTVYMX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.72 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|