C28H27Cl2N3O5 — CID 123721623
3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-ethyl-7-[5-(1-hydroxyprop-2-enylamino)-2-methoxyphenyl]-1,6-naphthyridin-2-one (PubChem CID 123721623) has the molecular formula C28H27Cl2N3O5 and a molecular weight of 556.45 g/mol. Its IUPAC name is 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-ethyl-7-[5-(1-hydroxyprop-2-enylamino)-2-methoxyphenyl]-1,6-naphthyridin-2-one.
| Compound Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-ethyl-7-[5-(1-hydroxyprop-2-enylamino)-2-methoxyphenyl]-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 123721623 |
| Molecular Formula | C28H27Cl2N3O5 |
| Molecular Weight | 556.45 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-ethyl-7-[5-(1-hydroxyprop-2-enylamino)-2-methoxyphenyl]-1,6-naphthyridin-2-one |
| SMILES | C=CC(O)Nc1ccc(OC)c(-c2cc3c(cn2)cc(-c2c(Cl)c(OC)cc(OC)c2Cl)c(=O)n3CC)c1 |
| InChI | InChI=1S/C28H27Cl2N3O5/c1-6-24(34)32-16-8-9-21(36-3)17(11-16)19-12-20-15(14-31-19)10-18(28(35)33(20)7-2)25-26(29)22(37-4)13-23(38-5)27(25)30/h6,8-14,24,32,34H,1,7H2,2-5H3 |
| InChIKey | DPGBHXBCQNPDKE-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.45 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|