C28H24Cl2FN3O4 — CID 118232136
N-[3-[3-(2,6-dichloro-3,5-dimethoxyphenyl)-2-oxo-1-propan-2-yl-1,6-naphthyridin-7-yl]-4-fluorophenyl]prop-2-enamide (PubChem CID 118232136) has the molecular formula C28H24Cl2FN3O4 and a molecular weight of 556.42 g/mol. Its IUPAC name is N-[3-[3-(2,6-dichloro-3,5-dimethoxyphenyl)-2-oxo-1-propan-2-yl-1,6-naphthyridin-7-yl]-4-fluorophenyl]prop-2-enamide.
| Compound Name | N-[3-[3-(2,6-dichloro-3,5-dimethoxyphenyl)-2-oxo-1-propan-2-yl-1,6-naphthyridin-7-yl]-4-fluorophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118232136 |
| Molecular Formula | C28H24Cl2FN3O4 |
| Molecular Weight | 556.42 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | N-[3-[3-(2,6-dichloro-3,5-dimethoxyphenyl)-2-oxo-1-propan-2-yl-1,6-naphthyridin-7-yl]-4-fluorophenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(F)c(-c2cc3c(cn2)cc(-c2c(Cl)c(OC)cc(OC)c2Cl)c(=O)n3C(C)C)c1 |
| InChI | InChI=1S/C28H24Cl2FN3O4/c1-6-24(35)33-16-7-8-19(31)17(10-16)20-11-21-15(13-32-20)9-18(28(36)34(21)14(2)3)25-26(29)22(37-4)12-23(38-5)27(25)30/h6-14H,1H2,2-5H3,(H,33,35) |
| InChIKey | RDUXFOAZFDYRDW-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.42 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|