C27H22Cl2N6O3 — CID 146412368
N-[2-[[4-(2,6-dichloro-3,5-dimethoxyphenyl)-2-methyl-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]amino]phenyl]prop-2-enamide (PubChem CID 146412368) has the molecular formula C27H22Cl2N6O3 and a molecular weight of 549.42 g/mol. Its IUPAC name is N-[2-[[4-(2,6-dichloro-3,5-dimethoxyphenyl)-2-methyl-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[4-(2,6-dichloro-3,5-dimethoxyphenyl)-2-methyl-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146412368 |
| Molecular Formula | C27H22Cl2N6O3 |
| Molecular Weight | 549.42 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | N-[2-[[4-(2,6-dichloro-3,5-dimethoxyphenyl)-2-methyl-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1cc2c(cn1)cc(-c1c(Cl)c(OC)cc(OC)c1Cl)c1nc(C)nn12 |
| InChI | InChI=1S/C27H22Cl2N6O3/c1-5-23(36)33-18-9-7-6-8-17(18)32-22-11-19-15(13-30-22)10-16(27-31-14(2)34-35(19)27)24-25(28)20(37-3)12-21(38-4)26(24)29/h5-13H,1H2,2-4H3,(H,30,32)(H,33,36) |
| InChIKey | BXFAAJZDBYFHOC-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.42 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|