C23H22Cl2N6O4 — CID 118029325
N-[2-[[6-[(2,6-dichloro-3,5-dimethoxyphenyl)carbamoyl-methylamino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 118029325) has the molecular formula C23H22Cl2N6O4 and a molecular weight of 517.37 g/mol. Its IUPAC name is N-[2-[[6-[(2,6-dichloro-3,5-dimethoxyphenyl)carbamoyl-methylamino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[6-[(2,6-dichloro-3,5-dimethoxyphenyl)carbamoyl-methylamino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118029325 |
| Molecular Formula | C23H22Cl2N6O4 |
| Molecular Weight | 517.37 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | N-[2-[[6-[(2,6-dichloro-3,5-dimethoxyphenyl)carbamoyl-methylamino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1cc(N(C)C(=O)Nc2c(Cl)c(OC)cc(OC)c2Cl)ncn1 |
| InChI | InChI=1S/C23H22Cl2N6O4/c1-5-19(32)29-14-9-7-6-8-13(14)28-17-11-18(27-12-26-17)31(2)23(33)30-22-20(24)15(34-3)10-16(35-4)21(22)25/h5-12H,1H2,2-4H3,(H,29,32)(H,30,33)(H,26,27,28) |
| InChIKey | SNAPABPRVHZAGB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.37 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|