C26H33Cl2N7O3 — CID 166113033
3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-methyl-1-[6-(4-piperazin-1-ylanilino)pyrimidin-4-yl]urea;ethane (PubChem CID 166113033) has the molecular formula C26H33Cl2N7O3 and a molecular weight of 562.50 g/mol. Its IUPAC name is 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-methyl-1-[6-(4-piperazin-1-ylanilino)pyrimidin-4-yl]urea;ethane.
| Compound Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-methyl-1-[6-(4-piperazin-1-ylanilino)pyrimidin-4-yl]urea;ethane |
|---|---|
| PubChem CID | 166113033 |
| Molecular Formula | C26H33Cl2N7O3 |
| Molecular Weight | 562.50 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-methyl-1-[6-(4-piperazin-1-ylanilino)pyrimidin-4-yl]urea;ethane |
| SMILES | CC.COc1cc(OC)c(Cl)c(NC(=O)N(C)c2cc(Nc3ccc(N4CCNCC4)cc3)ncn2)c1Cl |
| InChI | InChI=1S/C24H27Cl2N7O3.C2H6/c1-32(24(34)31-23-21(25)17(35-2)12-18(36-3)22(23)26)20-13-19(28-14-29-20)30-15-4-6-16(7-5-15)33-10-8-27-9-11-33;1-2/h4-7,12-14,27H,8-11H2,1-3H3,(H,31,34)(H,28,29,30);1-2H3 |
| InChIKey | YDJSTDXOACNZAK-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.50 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|