C24H27Cl2N7O3 — CID 174216516
1-(2,6-dichloro-3,5-dimethoxyphenyl)-1-methyl-3-[6-(4-piperazin-1-ylanilino)pyrimidin-4-yl]urea (PubChem CID 174216516) has the molecular formula C24H27Cl2N7O3 and a molecular weight of 532.43 g/mol. Its IUPAC name is 1-(2,6-dichloro-3,5-dimethoxyphenyl)-1-methyl-3-[6-(4-piperazin-1-ylanilino)pyrimidin-4-yl]urea.
| Compound Name | 1-(2,6-dichloro-3,5-dimethoxyphenyl)-1-methyl-3-[6-(4-piperazin-1-ylanilino)pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 174216516 |
| Molecular Formula | C24H27Cl2N7O3 |
| Molecular Weight | 532.43 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | 1-(2,6-dichloro-3,5-dimethoxyphenyl)-1-methyl-3-[6-(4-piperazin-1-ylanilino)pyrimidin-4-yl]urea |
| SMILES | COc1cc(OC)c(Cl)c(N(C)C(=O)Nc2cc(Nc3ccc(N4CCNCC4)cc3)ncn2)c1Cl |
| InChI | InChI=1S/C24H27Cl2N7O3/c1-32(23-21(25)17(35-2)12-18(36-3)22(23)26)24(34)31-20-13-19(28-14-29-20)30-15-4-6-16(7-5-15)33-10-8-27-9-11-33/h4-7,12-14,27H,8-11H2,1-3H3,(H2,28,29,30,31,34) |
| InChIKey | JLYHKSYHYAETPH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|