C25H29Cl2N7O4 — CID 145348552
3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-[6-(3-methoxy-4-piperazin-1-ylanilino)pyrimidin-4-yl]-1-methylurea (PubChem CID 145348552) has the molecular formula C25H29Cl2N7O4 and a molecular weight of 562.46 g/mol. Its IUPAC name is 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-[6-(3-methoxy-4-piperazin-1-ylanilino)pyrimidin-4-yl]-1-methylurea.
| Compound Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-[6-(3-methoxy-4-piperazin-1-ylanilino)pyrimidin-4-yl]-1-methylurea |
|---|---|
| PubChem CID | 145348552 |
| Molecular Formula | C25H29Cl2N7O4 |
| Molecular Weight | 562.46 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-[6-(3-methoxy-4-piperazin-1-ylanilino)pyrimidin-4-yl]-1-methylurea |
| SMILES | COc1cc(Nc2cc(N(C)C(=O)Nc3c(Cl)c(OC)cc(OC)c3Cl)ncn2)ccc1N1CCNCC1 |
| InChI | InChI=1S/C25H29Cl2N7O4/c1-33(25(35)32-24-22(26)18(37-3)12-19(38-4)23(24)27)21-13-20(29-14-30-21)31-15-5-6-16(17(11-15)36-2)34-9-7-28-8-10-34/h5-6,11-14,28H,7-10H2,1-4H3,(H,32,35)(H,29,30,31) |
| InChIKey | QGCZBQIJNJNESJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|