C28H31Cl2N7O4 — CID 138516017
1-[6-[[(4aR)-3-cyclopropyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]amino]pyrimidin-4-yl]-3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-methylurea (PubChem CID 138516017) has the molecular formula C28H31Cl2N7O4 and a molecular weight of 600.51 g/mol. Its IUPAC name is 1-[6-[[(4aR)-3-cyclopropyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]amino]pyrimidin-4-yl]-3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-methylurea.
| Compound Name | 1-[6-[[(4aR)-3-cyclopropyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]amino]pyrimidin-4-yl]-3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-methylurea |
|---|---|
| PubChem CID | 138516017 |
| Molecular Formula | C28H31Cl2N7O4 |
| Molecular Weight | 600.51 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | 1-[6-[[(4aR)-3-cyclopropyl-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]amino]pyrimidin-4-yl]-3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-methylurea |
| SMILES | COc1cc(OC)c(Cl)c(NC(=O)N(C)c2cc(Nc3ccc4c(c3)OC[C@H]3CN(C5CC5)CCN43)ncn2)c1Cl |
| InChI | InChI=1S/C28H31Cl2N7O4/c1-35(28(38)34-27-25(29)21(39-2)11-22(40-3)26(27)30)24-12-23(31-15-32-24)33-16-4-7-19-20(10-16)41-14-18-13-36(17-5-6-17)8-9-37(18)19/h4,7,10-12,15,17-18H,5-6,8-9,13-14H2,1-3H3,(H,34,38)(H,31,32,33)/t18-/m1/s1 |
| InChIKey | QCMDBRWWRZVNHM-GOSISDBHSA-N |
| XLogP | 5.26 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |