C24H22Cl2N6O4 — CID 118029145
N-[2-[[6-[(2,6-dichloro-3,5-dimethoxyphenyl)carbamoyl-methylamino]pyrimidin-4-yl]amino]phenyl]but-2-ynamide (PubChem CID 118029145) has the molecular formula C24H22Cl2N6O4 and a molecular weight of 529.38 g/mol. Its IUPAC name is N-[2-[[6-[(2,6-dichloro-3,5-dimethoxyphenyl)carbamoyl-methylamino]pyrimidin-4-yl]amino]phenyl]but-2-ynamide.
| Compound Name | N-[2-[[6-[(2,6-dichloro-3,5-dimethoxyphenyl)carbamoyl-methylamino]pyrimidin-4-yl]amino]phenyl]but-2-ynamide |
|---|---|
| PubChem CID | 118029145 |
| Molecular Formula | C24H22Cl2N6O4 |
| Molecular Weight | 529.38 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | N-[2-[[6-[(2,6-dichloro-3,5-dimethoxyphenyl)carbamoyl-methylamino]pyrimidin-4-yl]amino]phenyl]but-2-ynamide |
| SMILES | CC#CC(=O)Nc1ccccc1Nc1cc(N(C)C(=O)Nc2c(Cl)c(OC)cc(OC)c2Cl)ncn1 |
| InChI | InChI=1S/C24H22Cl2N6O4/c1-5-8-20(33)30-15-10-7-6-9-14(15)29-18-12-19(28-13-27-18)32(2)24(34)31-23-21(25)16(35-3)11-17(36-4)22(23)26/h6-7,9-13H,1-4H3,(H,30,33)(H,31,34)(H,27,28,29) |
| InChIKey | TXZVKYMXSUDFAU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.38 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|