C23H23Cl2FN6O3 — CID 137380916
3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-[6-[2-fluoro-6-(prop-2-enylamino)anilino]pyrimidin-4-yl]-1-methylurea (PubChem CID 137380916) has the molecular formula C23H23Cl2FN6O3 and a molecular weight of 521.38 g/mol. Its IUPAC name is 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-[6-[2-fluoro-6-(prop-2-enylamino)anilino]pyrimidin-4-yl]-1-methylurea.
| Compound Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-[6-[2-fluoro-6-(prop-2-enylamino)anilino]pyrimidin-4-yl]-1-methylurea |
|---|---|
| PubChem CID | 137380916 |
| Molecular Formula | C23H23Cl2FN6O3 |
| Molecular Weight | 521.38 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-[6-[2-fluoro-6-(prop-2-enylamino)anilino]pyrimidin-4-yl]-1-methylurea |
| SMILES | C=CCNc1cccc(F)c1Nc1cc(N(C)C(=O)Nc2c(Cl)c(OC)cc(OC)c2Cl)ncn1 |
| InChI | InChI=1S/C23H23Cl2FN6O3/c1-5-9-27-14-8-6-7-13(26)21(14)30-17-11-18(29-12-28-17)32(2)23(33)31-22-19(24)15(34-3)10-16(35-4)20(22)25/h5-8,10-12,27H,1,9H2,2-4H3,(H,31,33)(H,28,29,30) |
| InChIKey | IYTMDAJMSCDGTH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.38 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|