C24H25Cl2FN6O4 — CID 123189598
3-(2,6-dichloro-3,5-dimethoxycyclohexa-1,5-dien-1-yl)-1-[6-[2-[(2-ethenyloxiran-2-yl)amino]-6-fluoroanilino]pyrimidin-4-yl]-1-methylurea (PubChem CID 123189598) has the molecular formula C24H25Cl2FN6O4 and a molecular weight of 551.41 g/mol. Its IUPAC name is 3-(2,6-dichloro-3,5-dimethoxycyclohexa-1,5-dien-1-yl)-1-[6-[2-[(2-ethenyloxiran-2-yl)amino]-6-fluoroanilino]pyrimidin-4-yl]-1-methylurea.
| Compound Name | 3-(2,6-dichloro-3,5-dimethoxycyclohexa-1,5-dien-1-yl)-1-[6-[2-[(2-ethenyloxiran-2-yl)amino]-6-fluoroanilino]pyrimidin-4-yl]-1-methylurea |
|---|---|
| PubChem CID | 123189598 |
| Molecular Formula | C24H25Cl2FN6O4 |
| Molecular Weight | 551.41 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | 3-(2,6-dichloro-3,5-dimethoxycyclohexa-1,5-dien-1-yl)-1-[6-[2-[(2-ethenyloxiran-2-yl)amino]-6-fluoroanilino]pyrimidin-4-yl]-1-methylurea |
| SMILES | C=CC1(Nc2cccc(F)c2Nc2cc(N(C)C(=O)NC3=C(Cl)C(OC)CC(OC)=C3Cl)ncn2)CO1 |
| InChI | InChI=1S/C24H25Cl2FN6O4/c1-5-24(11-37-24)32-14-8-6-7-13(27)21(14)30-17-10-18(29-12-28-17)33(2)23(34)31-22-19(25)15(35-3)9-16(36-4)20(22)26/h5-8,10,12,15,32H,1,9,11H2,2-4H3,(H,31,34)(H,28,29,30) |
| InChIKey | ZZMJVTLZIQWKIA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|