C14H15N5O — CID 118029225
N-[2-[(6-aminopyrimidin-4-yl)amino]-3-methylphenyl]prop-2-enamide (PubChem CID 118029225) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is N-[2-[(6-aminopyrimidin-4-yl)amino]-3-methylphenyl]prop-2-enamide.
| Compound Name | N-[2-[(6-aminopyrimidin-4-yl)amino]-3-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118029225 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | N-[2-[(6-aminopyrimidin-4-yl)amino]-3-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(C)c1Nc1cc(N)ncn1 |
| InChI | InChI=1S/C14H15N5O/c1-3-13(20)18-10-6-4-5-9(2)14(10)19-12-7-11(15)16-8-17-12/h3-8H,1H2,2H3,(H,18,20)(H3,15,16,17,19) |
| InChIKey | VABPLOOMJJLJEM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|